C21H13F3N2O6 — CID 162054395
(2,4-dinitrophenyl) 2-[[3-(trifluoromethyl)phenyl]methyl]benzoate (PubChem CID 162054395) has the molecular formula C21H13F3N2O6 and a molecular weight of 446.34 g/mol. Its IUPAC name is (2,4-dinitrophenyl) 2-[[3-(trifluoromethyl)phenyl]methyl]benzoate.
| Compound Name | (2,4-dinitrophenyl) 2-[[3-(trifluoromethyl)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 162054395 |
| Molecular Formula | C21H13F3N2O6 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (2,4-dinitrophenyl) 2-[[3-(trifluoromethyl)phenyl]methyl]benzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F3N2O6/c22-21(23,24)15-6-3-4-13(11-15)10-14-5-1-2-7-17(14)20(27)32-19-9-8-16(25(28)29)12-18(19)26(30)31/h1-9,11-12H,10H2 |
| InChIKey | AIYBTCGQWFMFRJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|