C21H12N4O12 — CID 3090029
[3-(2,4-dinitrobenzoyl)oxy-2-methylphenyl] 2,4-dinitrobenzoate (PubChem CID 3090029) has the molecular formula C21H12N4O12 and a molecular weight of 512.34 g/mol. Its IUPAC name is [3-(2,4-dinitrobenzoyl)oxy-2-methylphenyl] 2,4-dinitrobenzoate.
| Compound Name | [3-(2,4-dinitrobenzoyl)oxy-2-methylphenyl] 2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 3090029 |
| Molecular Formula | C21H12N4O12 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | [3-(2,4-dinitrobenzoyl)oxy-2-methylphenyl] 2,4-dinitrobenzoate |
| SMILES | Cc1c(OC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cccc1OC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H12N4O12/c1-11-18(36-20(26)14-7-5-12(22(28)29)9-16(14)24(32)33)3-2-4-19(11)37-21(27)15-8-6-13(23(30)31)10-17(15)25(34)35/h2-10H,1H3 |
| InChIKey | OTYGNMASNVGLTP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 225.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|