C24H12F3N3O11 — CID 4073369
[8-methyl-3-(4-nitrophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2,4-dinitrobenzoate (PubChem CID 4073369) has the molecular formula C24H12F3N3O11 and a molecular weight of 575.36 g/mol. Its IUPAC name is [8-methyl-3-(4-nitrophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2,4-dinitrobenzoate.
| Compound Name | [8-methyl-3-(4-nitrophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 4073369 |
| Molecular Formula | C24H12F3N3O11 |
| Molecular Weight | 575.36 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | [8-methyl-3-(4-nitrophenoxy)-4-oxo-2-(trifluoromethyl)chromen-7-yl] 2,4-dinitrobenzoate |
| SMILES | Cc1c(OC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc2c(=O)c(Oc3ccc([N+](=O)[O-])cc3)c(C(F)(F)F)oc12 |
| InChI | InChI=1S/C24H12F3N3O11/c1-11-18(40-23(32)15-7-4-13(29(35)36)10-17(15)30(37)38)9-8-16-19(31)21(22(24(25,26)27)41-20(11)16)39-14-5-2-12(3-6-14)28(33)34/h2-10H,1H3 |
| InChIKey | VIVUFFCADCHVJS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 195.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|