C22H16F3N3O4 — CID 60589058
2-[[2-(4-nitrophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 60589058) has the molecular formula C22H16F3N3O4 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-[[2-(4-nitrophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[[2-(4-nitrophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 60589058 |
| Molecular Formula | C22H16F3N3O4 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[[2-(4-nitrophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccccc1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N3O4/c23-22(24,25)15-4-3-5-16(13-15)26-21(30)18-6-1-2-7-19(18)27-20(29)12-14-8-10-17(11-9-14)28(31)32/h1-11,13H,12H2,(H,26,30)(H,27,29) |
| InChIKey | ZYUONVHXIFMUMZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|