About 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile
1-nitro-3-(trifluoromethyl)benzene;oxalonitrile (PubChem CID 159395487) has the molecular formula C9H4F3N3O2
and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile.
Molecular Properties
| Compound Name | 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile |
| PubChem CID | 159395487 |
| Molecular Formula | C9H4F3N3O2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile |
| SMILES | N#CC#N.O=[N+]([O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H4F3NO2.C2N2/c8-7(9,10)5-2-1-3-6(4-5)11(12)13;3-1-2-4/h1-4H; |
| InChIKey | LMQSYORYVSLBJV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile?
The IUPAC name of 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile (CID 159395487) is 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile.
What is the SMILES notation for 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile?
The canonical SMILES for 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile is N#CC#N.O=[N+]([O-])c1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile?
The InChIKey is LMQSYORYVSLBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO2.C2N2/c8-7(9,10)5-2-1-3-6(4-5)11(12)13;3-1-2-4/h1-4H;.
What are the key properties of 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile?
1-nitro-3-(trifluoromethyl)benzene;oxalonitrile has a molecular weight of 243.14 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-3-(trifluoromethyl)benzene;oxalonitrile is sourced from PubChem (CID 159395487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).