C16H9F8NO3 — CID 162511686
2,2,3,3,3-pentafluoro-1-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 162511686) has the molecular formula C16H9F8NO3 and a molecular weight of 415.24 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 162511686 |
| Molecular Formula | C16H9F8NO3 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | O=[N+]([O-])c1cccc(C(O)(c2cccc(C(F)(F)F)c2)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9F8NO3/c17-14(18,19)11-5-1-3-9(7-11)13(26,15(20,21)16(22,23)24)10-4-2-6-12(8-10)25(27)28/h1-8,26H |
| InChIKey | VDRAEDOKGADGLA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|