C12H10F3NO8 — CID 174293600
2-formyl-2-hydroxybutanedioic acid;1-nitro-3-(trifluoromethyl)benzene (PubChem CID 174293600) has the molecular formula C12H10F3NO8 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-formyl-2-hydroxybutanedioic acid;1-nitro-3-(trifluoromethyl)benzene.
| Compound Name | 2-formyl-2-hydroxybutanedioic acid;1-nitro-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 174293600 |
| Molecular Formula | C12H10F3NO8 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-formyl-2-hydroxybutanedioic acid;1-nitro-3-(trifluoromethyl)benzene |
| SMILES | O=CC(O)(CC(=O)O)C(=O)O.O=[N+]([O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H4F3NO2.C5H6O6/c8-7(9,10)5-2-1-3-6(4-5)11(12)13;6-2-5(11,4(9)10)1-3(7)8/h1-4H;2,11H,1H2,(H,7,8)(H,9,10) |
| InChIKey | SWWTYJLQLXFRPN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|