C11H10F5NO3 — CID 162347350
4,4,5,5,5-pentafluoro-2-(3-nitrophenyl)pentan-2-ol (PubChem CID 162347350) has the molecular formula C11H10F5NO3 and a molecular weight of 299.20 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-2-(3-nitrophenyl)pentan-2-ol.
| Compound Name | 4,4,5,5,5-pentafluoro-2-(3-nitrophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 162347350 |
| Molecular Formula | C11H10F5NO3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-2-(3-nitrophenyl)pentan-2-ol |
| SMILES | CC(O)(CC(F)(F)C(F)(F)F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10F5NO3/c1-9(18,6-10(12,13)11(14,15)16)7-3-2-4-8(5-7)17(19)20/h2-5,18H,6H2,1H3 |
| InChIKey | TZBMDMGMDOERJD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|