C18H16F15NO — CID 156764472
2-[3-(dimethylamino)phenyl]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol (PubChem CID 156764472) has the molecular formula C18H16F15NO and a molecular weight of 547.30 g/mol. Its IUPAC name is 2-[3-(dimethylamino)phenyl]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol.
| Compound Name | 2-[3-(dimethylamino)phenyl]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol |
|---|---|
| PubChem CID | 156764472 |
| Molecular Formula | C18H16F15NO |
| Molecular Weight | 547.30 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 2-[3-(dimethylamino)phenyl]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-ol |
| SMILES | CN(C)c1cccc(C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F15NO/c1-11(35,9-5-4-6-10(7-9)34(2)3)8-12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)33/h4-7,35H,8H2,1-3H3 |
| InChIKey | ZQTQQELXYRRLFM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.30 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|