C18H18F13NO — CID 156763948
N,N-dimethyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)aniline (PubChem CID 156763948) has the molecular formula C18H18F13NO and a molecular weight of 511.32 g/mol. Its IUPAC name is N,N-dimethyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)aniline.
| Compound Name | N,N-dimethyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)aniline |
|---|---|
| PubChem CID | 156763948 |
| Molecular Formula | C18H18F13NO |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | N,N-dimethyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)aniline |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C18H18F13NO/c1-12(33-4,10-6-5-7-11(8-10)32(2)3)9-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h5-8H,9H2,1-4H3 |
| InChIKey | WQXFFIHKIGASDK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|