C13H15F5O — CID 156765438
1-methyl-3-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene (PubChem CID 156765438) has the molecular formula C13H15F5O and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-methyl-3-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene.
| Compound Name | 1-methyl-3-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
|---|---|
| PubChem CID | 156765438 |
| Molecular Formula | C13H15F5O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-methyl-3-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C13H15F5O/c1-9-5-4-6-10(7-9)11(2,19-3)8-12(14,15)13(16,17)18/h4-7H,8H2,1-3H3 |
| InChIKey | BMNXOQLDCFKBQW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|