C12H12ClF5O — CID 156764476
1-chloro-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene (PubChem CID 156764476) has the molecular formula C12H12ClF5O and a molecular weight of 302.67 g/mol. Its IUPAC name is 1-chloro-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene.
| Compound Name | 1-chloro-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
|---|---|
| PubChem CID | 156764476 |
| Molecular Formula | C12H12ClF5O |
| Molecular Weight | 302.67 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-chloro-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClF5O/c1-10(19-2,7-11(14,15)12(16,17)18)8-3-5-9(13)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | OLQOHMQPWQUSAQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|