C16H21F5O — CID 156765898
1-butan-2-yl-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene (PubChem CID 156765898) has the molecular formula C16H21F5O and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-butan-2-yl-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene.
| Compound Name | 1-butan-2-yl-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
|---|---|
| PubChem CID | 156765898 |
| Molecular Formula | C16H21F5O |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-butan-2-yl-4-(4,4,5,5,5-pentafluoro-2-methoxypentan-2-yl)benzene |
| SMILES | CCC(C)c1ccc(C(C)(CC(F)(F)C(F)(F)F)OC)cc1 |
| InChI | InChI=1S/C16H21F5O/c1-5-11(2)12-6-8-13(9-7-12)14(3,22-4)10-15(17,18)16(19,20)21/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | OLRVNQCCBNVUPA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|