C12H13F2N — CID 116840569
2-(4-butan-2-ylphenyl)-2,2-difluoroacetonitrile (PubChem CID 116840569) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-2,2-difluoroacetonitrile.
| Compound Name | 2-(4-butan-2-ylphenyl)-2,2-difluoroacetonitrile |
|---|---|
| PubChem CID | 116840569 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-2,2-difluoroacetonitrile |
| SMILES | CCC(C)c1ccc(C(F)(F)C#N)cc1 |
| InChI | InChI=1S/C12H13F2N/c1-3-9(2)10-4-6-11(7-5-10)12(13,14)8-15/h4-7,9H,3H2,1-2H3 |
| InChIKey | LCNBPSLKJJTCOE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |