C15H18F3N — CID 155351110
(3S)-2,2-diethyl-3-[4-(trifluoromethyl)phenyl]butanenitrile (PubChem CID 155351110) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is (3S)-2,2-diethyl-3-[4-(trifluoromethyl)phenyl]butanenitrile.
| Compound Name | (3S)-2,2-diethyl-3-[4-(trifluoromethyl)phenyl]butanenitrile |
|---|---|
| PubChem CID | 155351110 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (3S)-2,2-diethyl-3-[4-(trifluoromethyl)phenyl]butanenitrile |
| SMILES | CCC(C#N)(CC)[C@@H](C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3N/c1-4-14(5-2,10-19)11(3)12-6-8-13(9-7-12)15(16,17)18/h6-9,11H,4-5H2,1-3H3/t11-/m0/s1 |
| InChIKey | PBVZPBVGSHBKDV-NSHDSACASA-N |
| XLogP | 5.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |