About 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane
3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane (PubChem CID 175935687) has the molecular formula C10H12F3N3
and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane.
Molecular Properties
| Compound Name | 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane |
| PubChem CID | 175935687 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane |
| SMILES | N.N#CC(CN)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F3N2.H3N/c11-10(12,13)9-3-1-7(2-4-9)8(5-14)6-15;/h1-4,8H,5,14H2;1H3 |
| InChIKey | WETFJGOCRYOHAO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane?
The IUPAC name of 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane (CID 175935687) is 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane.
What is the SMILES notation for 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane?
The canonical SMILES for 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane is N.N#CC(CN)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane?
The InChIKey is WETFJGOCRYOHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2.H3N/c11-10(12,13)9-3-1-7(2-4-9)8(5-14)6-15;/h1-4,8H,5,14H2;1H3.
What are the key properties of 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane?
3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane has a molecular weight of 231.22 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[4-(trifluoromethyl)phenyl]propanenitrile;azane is sourced from PubChem (CID 175935687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).