C11H11F3N2 — CID 86782131
2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetonitrile (PubChem CID 86782131) has the molecular formula C11H11F3N2 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetonitrile.
| Compound Name | 2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetonitrile |
|---|---|
| PubChem CID | 86782131 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetonitrile |
| SMILES | CC(NCC#N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3N2/c1-8(16-7-6-15)9-2-4-10(5-3-9)11(12,13)14/h2-5,8,16H,7H2,1H3 |
| InChIKey | IQHFWTIYCNMCAZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|