C13H17F3N2O — CID 43566828
N-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetamide (PubChem CID 43566828) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetamide.
| Compound Name | N-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetamide |
|---|---|
| PubChem CID | 43566828 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]acetamide |
| SMILES | CCNC(=O)CNC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O/c1-3-17-12(19)8-18-9(2)10-4-6-11(7-5-10)13(14,15)16/h4-7,9,18H,3,8H2,1-2H3,(H,17,19) |
| InChIKey | SRBMWSURHZPONQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |