C18H19F3N2O — CID 42955452
N-[4-[[1-[4-(trifluoromethyl)phenyl]ethylamino]methyl]phenyl]acetamide (PubChem CID 42955452) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[4-[[1-[4-(trifluoromethyl)phenyl]ethylamino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-[4-(trifluoromethyl)phenyl]ethylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 42955452 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[4-[[1-[4-(trifluoromethyl)phenyl]ethylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNC(C)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H19F3N2O/c1-12(15-5-7-16(8-6-15)18(19,20)21)22-11-14-3-9-17(10-4-14)23-13(2)24/h3-10,12,22H,11H2,1-2H3,(H,23,24) |
| InChIKey | XPBSRAAPULSJFI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |