C14H14F3N3 — CID 62763608
N-(pyrazin-2-ylmethyl)-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 62763608) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is N-(pyrazin-2-ylmethyl)-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-(pyrazin-2-ylmethyl)-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 62763608 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(pyrazin-2-ylmethyl)-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(NCc1cnccn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F3N3/c1-10(20-9-13-8-18-6-7-19-13)11-2-4-12(5-3-11)14(15,16)17/h2-8,10,20H,9H2,1H3 |
| InChIKey | JTAAXEMEVHGERO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |