C13H15F5O — CID 20756244
2-(4-butan-2-ylphenyl)-1,1,1,3,3-pentafluoropropan-2-ol (PubChem CID 20756244) has the molecular formula C13H15F5O and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-1,1,1,3,3-pentafluoropropan-2-ol.
| Compound Name | 2-(4-butan-2-ylphenyl)-1,1,1,3,3-pentafluoropropan-2-ol |
|---|---|
| PubChem CID | 20756244 |
| Molecular Formula | C13H15F5O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-1,1,1,3,3-pentafluoropropan-2-ol |
| SMILES | CCC(C)c1ccc(C(O)(C(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F5O/c1-3-8(2)9-4-6-10(7-5-9)12(19,11(14)15)13(16,17)18/h4-8,11,19H,3H2,1-2H3 |
| InChIKey | PFZIJNPZEMTPCD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |