C19H19F11O — CID 162348435
2-(4-butan-2-ylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol (PubChem CID 162348435) has the molecular formula C19H19F11O and a molecular weight of 472.34 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol.
| Compound Name | 2-(4-butan-2-ylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 162348435 |
| Molecular Formula | C19H19F11O |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol |
| SMILES | CCC(C)c1ccc(C(C)(O)CC2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C19H19F11O/c1-4-10(2)11-5-7-12(8-6-11)13(3,31)9-14(20)15(21,22)17(25,26)19(29,30)18(27,28)16(14,23)24/h5-8,10,31H,4,9H2,1-3H3 |
| InChIKey | HJJZXNXQTRTNKW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|