C14H10F9NO3 — CID 162347476
2-(4-nitrophenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol (PubChem CID 162347476) has the molecular formula C14H10F9NO3 and a molecular weight of 411.22 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol.
| Compound Name | 2-(4-nitrophenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol |
|---|---|
| PubChem CID | 162347476 |
| Molecular Formula | C14H10F9NO3 |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-(4-nitrophenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol |
| SMILES | CC(O)(CC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10F9NO3/c1-9(25,7-2-4-8(5-3-7)24(26)27)6-10(15)11(16,17)13(20,21)14(22,23)12(10,18)19/h2-5,25H,6H2,1H3 |
| InChIKey | DYUONXYQQLCOBO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|