C16H17NO4 — CID 70228127
3-(4-nitrophenyl)-1-phenylbutane-1,3-diol (PubChem CID 70228127) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-phenylbutane-1,3-diol.
| Compound Name | 3-(4-nitrophenyl)-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 70228127 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-(4-nitrophenyl)-1-phenylbutane-1,3-diol |
| SMILES | CC(O)(CC(O)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO4/c1-16(19,11-15(18)12-5-3-2-4-6-12)13-7-9-14(10-8-13)17(20)21/h2-10,15,18-19H,11H2,1H3 |
| InChIKey | IFYNBTBRCSBJLZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|