C14H12N2O5 — CID 88671107
2-(3,5-dinitrophenyl)-1-phenylethanol (PubChem CID 88671107) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-(3,5-dinitrophenyl)-1-phenylethanol.
| Compound Name | 2-(3,5-dinitrophenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 88671107 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(3,5-dinitrophenyl)-1-phenylethanol |
| SMILES | O=[N+]([O-])c1cc(CC(O)c2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O5/c17-14(11-4-2-1-3-5-11)8-10-6-12(15(18)19)9-13(7-10)16(20)21/h1-7,9,14,17H,8H2 |
| InChIKey | IAMQYEBWKRZGSI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|