C24H25NO7 — CID 12030579
2,6-bis[[(2R)-2-hydroxy-2-phenylethoxy]methyl]-4-nitrophenol (PubChem CID 12030579) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2,6-bis[[(2R)-2-hydroxy-2-phenylethoxy]methyl]-4-nitrophenol.
| Compound Name | 2,6-bis[[(2R)-2-hydroxy-2-phenylethoxy]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 12030579 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2,6-bis[[(2R)-2-hydroxy-2-phenylethoxy]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(COC[C@H](O)c2ccccc2)c(O)c(COC[C@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO7/c26-22(17-7-3-1-4-8-17)15-31-13-19-11-21(25(29)30)12-20(24(19)28)14-32-16-23(27)18-9-5-2-6-10-18/h1-12,22-23,26-28H,13-16H2/t22-,23-/m0/s1 |
| InChIKey | VFSHOBHCMKZYBN-GOTSBHOMSA-N |
| XLogP | 3.80 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|