C13H14F6O — CID 23533128
2-(3-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 23533128) has the molecular formula C13H14F6O and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-(3-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 23533128 |
| Molecular Formula | C13H14F6O |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(3-butan-2-ylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6O/c1-3-8(2)9-5-4-6-10(7-9)11(20,12(14,15)16)13(17,18)19/h4-8,20H,3H2,1-2H3 |
| InChIKey | BRBUBBGFIIIVDP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |