C19H27F3O2 — CID 58364107
1-butan-2-yl-4-[1,1,1-trifluoro-2-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]propan-2-yl]benzene (PubChem CID 58364107) has the molecular formula C19H27F3O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-butan-2-yl-4-[1,1,1-trifluoro-2-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]propan-2-yl]benzene.
| Compound Name | 1-butan-2-yl-4-[1,1,1-trifluoro-2-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 58364107 |
| Molecular Formula | C19H27F3O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-butan-2-yl-4-[1,1,1-trifluoro-2-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]propan-2-yl]benzene |
| SMILES | C=C(OC(C)(C)C)OC(C)(c1ccc(C(C)CC)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O2/c1-8-13(2)15-9-11-16(12-10-15)18(7,19(20,21)22)24-14(3)23-17(4,5)6/h9-13H,3,8H2,1-2,4-7H3 |
| InChIKey | KNRFPMOKGATMCX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|