C15H17F7O — CID 156765862
1-ethyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene (PubChem CID 156765862) has the molecular formula C15H17F7O and a molecular weight of 346.29 g/mol. Its IUPAC name is 1-ethyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene.
| Compound Name | 1-ethyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
|---|---|
| PubChem CID | 156765862 |
| Molecular Formula | C15H17F7O |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-ethyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
| SMILES | CCc1ccc(C(C)(CC(F)(F)C(F)(F)C(F)(F)F)OC)cc1 |
| InChI | InChI=1S/C15H17F7O/c1-4-10-5-7-11(8-6-10)12(2,23-3)9-13(16,17)14(18,19)15(20,21)22/h5-8H,4,9H2,1-3H3 |
| InChIKey | WBFYMUOUYQARJH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|