C18H21F9O2 — CID 156763335
1-(2-methylpropoxy)-3-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene (PubChem CID 156763335) has the molecular formula C18H21F9O2 and a molecular weight of 440.35 g/mol. Its IUPAC name is 1-(2-methylpropoxy)-3-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene.
| Compound Name | 1-(2-methylpropoxy)-3-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
|---|---|
| PubChem CID | 156763335 |
| Molecular Formula | C18H21F9O2 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-(2-methylpropoxy)-3-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C18H21F9O2/c1-11(2)9-29-13-7-5-6-12(8-13)14(3,28-4)10-15(19,20)16(21,22)17(23,24)18(25,26)27/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | NHUFIBGGKTYBRL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|