C18H19F11O2 — CID 156765720
2-(3-butan-2-yloxyphenyl)-4,4,5,5,6,6,7,7,8,8,8-undecafluorooctan-2-ol (PubChem CID 156765720) has the molecular formula C18H19F11O2 and a molecular weight of 476.33 g/mol. Its IUPAC name is 2-(3-butan-2-yloxyphenyl)-4,4,5,5,6,6,7,7,8,8,8-undecafluorooctan-2-ol.
| Compound Name | 2-(3-butan-2-yloxyphenyl)-4,4,5,5,6,6,7,7,8,8,8-undecafluorooctan-2-ol |
|---|---|
| PubChem CID | 156765720 |
| Molecular Formula | C18H19F11O2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-(3-butan-2-yloxyphenyl)-4,4,5,5,6,6,7,7,8,8,8-undecafluorooctan-2-ol |
| SMILES | CCC(C)Oc1cccc(C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F11O2/c1-4-10(2)31-12-7-5-6-11(8-12)13(3,30)9-14(19,20)15(21,22)16(23,24)17(25,26)18(27,28)29/h5-8,10,30H,4,9H2,1-3H3 |
| InChIKey | MASJJKNKHFZDJB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|