C18H19F9O2 — CID 162348296
2-(3-butan-2-yloxyphenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol (PubChem CID 162348296) has the molecular formula C18H19F9O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 2-(3-butan-2-yloxyphenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol.
| Compound Name | 2-(3-butan-2-yloxyphenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol |
|---|---|
| PubChem CID | 162348296 |
| Molecular Formula | C18H19F9O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-(3-butan-2-yloxyphenyl)-1-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propan-2-ol |
| SMILES | CCC(C)Oc1cccc(C(C)(O)CC2(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C18H19F9O2/c1-4-10(2)29-12-7-5-6-11(8-12)13(3,28)9-14(19)15(20,21)17(24,25)18(26,27)16(14,22)23/h5-8,10,28H,4,9H2,1-3H3 |
| InChIKey | BZZKARBVGNKNSA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|