C10H13F2NO2 — CID 107105450
1-amino-2-[3-(difluoromethoxy)phenyl]propan-2-ol (PubChem CID 107105450) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-amino-2-[3-(difluoromethoxy)phenyl]propan-2-ol.
| Compound Name | 1-amino-2-[3-(difluoromethoxy)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 107105450 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-amino-2-[3-(difluoromethoxy)phenyl]propan-2-ol |
| SMILES | CC(O)(CN)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C10H13F2NO2/c1-10(14,6-13)7-3-2-4-8(5-7)15-9(11)12/h2-5,9,14H,6,13H2,1H3 |
| InChIKey | BQWKDBVDQQGXJI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |