C17H20F9NO — CID 156764046
2-[3-(diethylamino)phenyl]-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol (PubChem CID 156764046) has the molecular formula C17H20F9NO and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-[3-(diethylamino)phenyl]-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol.
| Compound Name | 2-[3-(diethylamino)phenyl]-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
|---|---|
| PubChem CID | 156764046 |
| Molecular Formula | C17H20F9NO |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[3-(diethylamino)phenyl]-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
| SMILES | CCN(CC)c1cccc(C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F9NO/c1-4-27(5-2)12-8-6-7-11(9-12)13(3,28)10-14(18,19)15(20,21)16(22,23)17(24,25)26/h6-9,28H,4-5,10H2,1-3H3 |
| InChIKey | FKBRAYGPIOUSGV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|