C19H17F16NO — CID 162348005
2-[4-(diethylamino)phenyl]-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol (PubChem CID 162348005) has the molecular formula C19H17F16NO and a molecular weight of 579.32 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol.
| Compound Name | 2-[4-(diethylamino)phenyl]-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol |
|---|---|
| PubChem CID | 162348005 |
| Molecular Formula | C19H17F16NO |
| Molecular Weight | 579.32 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-1,1,1,4,4,5,5,6,6,7,7,8,8,9,9,9-hexadecafluorononan-2-ol |
| SMILES | CCN(CC)c1ccc(C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F16NO/c1-3-36(4-2)11-7-5-10(6-8-11)12(37,18(30,31)32)9-13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)19(33,34)35/h5-8,37H,3-4,9H2,1-2H3 |
| InChIKey | ILJLHBCHLNEZJF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.32 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|