C13H14F7NO — CID 22734616
2-[N-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]ethanol (PubChem CID 22734616) has the molecular formula C13H14F7NO and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-[N-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]ethanol |
|---|---|
| PubChem CID | 22734616 |
| Molecular Formula | C13H14F7NO |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[N-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F7NO/c1-2-21(7-8-22)10-5-3-9(4-6-10)11(14,12(15,16)17)13(18,19)20/h3-6,22H,2,7-8H2,1H3 |
| InChIKey | PQWSOMHWNNUTHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |