C18H19F3N2O2 — CID 154649178
2-[N-(2-hydroxyethyl)-4-[4-(trifluoromethyl)benzenecarboximidoyl]anilino]ethanol (PubChem CID 154649178) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[4-(trifluoromethyl)benzenecarboximidoyl]anilino]ethanol.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[4-(trifluoromethyl)benzenecarboximidoyl]anilino]ethanol |
|---|---|
| PubChem CID | 154649178 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[4-(trifluoromethyl)benzenecarboximidoyl]anilino]ethanol |
| SMILES | [H]/N=C(\c1ccc(N(CCO)CCO)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2/c19-18(20,21)15-5-1-13(2-6-15)17(22)14-3-7-16(8-4-14)23(9-11-24)10-12-25/h1-8,22,24-25H,9-12H2/b22-17- |
| InChIKey | MNZWBFUDWOFTJA-XLNRJJMWSA-N |
| XLogP | 2.91 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|