C10H13F3N2O — CID 107478278
2-[4-amino-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 107478278) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[4-amino-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[4-amino-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107478278 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[4-amino-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | Nc1ccc(N(CCO)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)7-15(5-6-16)9-3-1-8(14)2-4-9/h1-4,16H,5-7,14H2 |
| InChIKey | YUMCYHSMKJPLAO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|