C13H19F3N2O2 — CID 107478314
2-[3-amino-5-propoxy-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 107478314) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[3-amino-5-propoxy-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[3-amino-5-propoxy-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107478314 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[3-amino-5-propoxy-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | CCCOc1cc(N)cc(N(CCO)CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H19F3N2O2/c1-2-5-20-12-7-10(17)6-11(8-12)18(3-4-19)9-13(14,15)16/h6-8,19H,2-5,9,17H2,1H3 |
| InChIKey | OCJKIPHTPNNNFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|