C10H11F5N2O — CID 112751860
2-[2-amino-4,5-difluoro-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 112751860) has the molecular formula C10H11F5N2O and a molecular weight of 270.20 g/mol. Its IUPAC name is 2-[2-amino-4,5-difluoro-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[2-amino-4,5-difluoro-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 112751860 |
| Molecular Formula | C10H11F5N2O |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[2-amino-4,5-difluoro-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | Nc1cc(F)c(F)cc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H11F5N2O/c11-6-3-8(16)9(4-7(6)12)17(1-2-18)5-10(13,14)15/h3-4,18H,1-2,5,16H2 |
| InChIKey | XJDPRAWMXKHESC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|