C10H14F3N3O3S — CID 107478271
4-amino-3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide (PubChem CID 107478271) has the molecular formula C10H14F3N3O3S and a molecular weight of 313.30 g/mol. Its IUPAC name is 4-amino-3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide.
| Compound Name | 4-amino-3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 107478271 |
| Molecular Formula | C10H14F3N3O3S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-amino-3-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O3S/c11-10(12,13)6-16(3-4-17)9-5-7(20(15,18)19)1-2-8(9)14/h1-2,5,17H,3-4,6,14H2,(H2,15,18,19) |
| InChIKey | BHBNTRZUKWFHBS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|