C10H12F3N3O3 — CID 107478310
2-[2-amino-4-nitro-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 107478310) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-[2-amino-4-nitro-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[2-amino-4-nitro-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107478310 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[2-amino-4-nitro-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | Nc1cc([N+](=O)[O-])ccc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O3/c11-10(12,13)6-15(3-4-17)9-2-1-7(16(18)19)5-8(9)14/h1-2,5,17H,3-4,6,14H2 |
| InChIKey | WBMTWAWOGYSWKE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|