C11H8F3N3O4 — CID 79261997
2-[2-cyano-4-nitro-N-(2,2,2-trifluoroethyl)anilino]acetic acid (PubChem CID 79261997) has the molecular formula C11H8F3N3O4 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-[2-cyano-4-nitro-N-(2,2,2-trifluoroethyl)anilino]acetic acid.
| Compound Name | 2-[2-cyano-4-nitro-N-(2,2,2-trifluoroethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 79261997 |
| Molecular Formula | C11H8F3N3O4 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[2-cyano-4-nitro-N-(2,2,2-trifluoroethyl)anilino]acetic acid |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C11H8F3N3O4/c12-11(13,14)6-16(5-10(18)19)9-2-1-8(17(20)21)3-7(9)4-15/h1-3H,5-6H2,(H,18,19) |
| InChIKey | CQMYVMWMNMRGTP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|