C13H11F3N2O2 — CID 79265026
2-[2-cyano-N-prop-2-enyl-4-(trifluoromethyl)anilino]acetic acid (PubChem CID 79265026) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[2-cyano-N-prop-2-enyl-4-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-[2-cyano-N-prop-2-enyl-4-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 79265026 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[2-cyano-N-prop-2-enyl-4-(trifluoromethyl)anilino]acetic acid |
| SMILES | C=CCN(CC(=O)O)c1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H11F3N2O2/c1-2-5-18(8-12(19)20)11-4-3-10(13(14,15)16)6-9(11)7-17/h2-4,6H,1,5,8H2,(H,19,20) |
| InChIKey | PIYCCOCULPRLHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|