C10H8F3N3O2 — CID 115500978
2-[methyl(2,2,2-trifluoroethyl)amino]-5-nitrobenzonitrile (PubChem CID 115500978) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)amino]-5-nitrobenzonitrile.
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500978 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-5-nitrobenzonitrile |
| SMILES | CN(CC(F)(F)F)c1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C10H8F3N3O2/c1-15(6-10(11,12)13)9-3-2-8(16(17)18)4-7(9)5-14/h2-4H,6H2,1H3 |
| InChIKey | JDLRWOIQCKHHRU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|