C17H15N3O4 — CID 9185653
2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-5-nitrobenzonitrile (PubChem CID 9185653) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-5-nitrobenzonitrile.
| Compound Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 9185653 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(methyl)amino]-5-nitrobenzonitrile |
| SMILES | CN(Cc1ccc2c(c1)OCCO2)c1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C17H15N3O4/c1-19(15-4-3-14(20(21)22)9-13(15)10-18)11-12-2-5-16-17(8-12)24-7-6-23-16/h2-5,8-9H,6-7,11H2,1H3 |
| InChIKey | ZOLCZRMVNFWADF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|