C22H35NO11 — CID 14294030
29-nitro-2,5,8,11,14,17,20,23,26-nonaoxabicyclo[25.4.0]hentriaconta-1(27),28,30-triene (PubChem CID 14294030) has the molecular formula C22H35NO11 and a molecular weight of 489.52 g/mol. Its IUPAC name is 29-nitro-2,5,8,11,14,17,20,23,26-nonaoxabicyclo[25.4.0]hentriaconta-1(27),28,30-triene.
| Compound Name | 29-nitro-2,5,8,11,14,17,20,23,26-nonaoxabicyclo[25.4.0]hentriaconta-1(27),28,30-triene |
|---|---|
| PubChem CID | 14294030 |
| Molecular Formula | C22H35NO11 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 29-nitro-2,5,8,11,14,17,20,23,26-nonaoxabicyclo[25.4.0]hentriaconta-1(27),28,30-triene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCOCCOCCOCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C22H35NO11/c24-23(25)20-1-2-21-22(19-20)34-18-16-32-14-12-30-10-8-28-6-4-26-3-5-27-7-9-29-11-13-31-15-17-33-21/h1-2,19H,3-18H2 |
| InChIKey | QLCAXGOCNJYNQS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 126.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|