C12H15NO4 — CID 15048232
10-nitro-2,3,4,5,6,7-hexahydro-1,8-benzodioxecine (PubChem CID 15048232) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 10-nitro-2,3,4,5,6,7-hexahydro-1,8-benzodioxecine.
| Compound Name | 10-nitro-2,3,4,5,6,7-hexahydro-1,8-benzodioxecine |
|---|---|
| PubChem CID | 15048232 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 10-nitro-2,3,4,5,6,7-hexahydro-1,8-benzodioxecine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCCCCCO2 |
| InChI | InChI=1S/C12H15NO4/c14-13(15)10-5-6-11-12(9-10)17-8-4-2-1-3-7-16-11/h5-6,9H,1-4,7-8H2 |
| InChIKey | MJCDMGACZHLYGW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|