C10H10NO5Si — CID 175153260
CID 175153260 (PubChem CID 175153260) has the molecular formula C10H10NO5Si and a molecular weight of 252.28 g/mol.
| Compound Name | CID 175153260 |
|---|---|
| PubChem CID | 175153260 |
| Molecular Formula | C10H10NO5Si |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCC(CO[Si])O2 |
| InChI | InChI=1S/C10H10NO5Si/c12-11(13)7-1-2-9-10(5-7)14-4-3-8(16-9)6-15-17/h1-2,5,8H,3-4,6H2 |
| InChIKey | BETKYHDHOUFNNS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|