About 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde
6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde (PubChem CID 59397335) has the molecular formula C10H9NO4
and a molecular weight of 207.19 g/mol. Its IUPAC name is 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde.
Molecular Properties
| Compound Name | 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde |
| PubChem CID | 59397335 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde |
| SMILES | O=CC1CCOc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H9NO4/c12-6-7-3-4-15-10-2-1-8(11(13)14)5-9(7)10/h1-2,5-7H,3-4H2 |
| InChIKey | DQRVBEXRTJYKEU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde?
The IUPAC name of 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde (CID 59397335) is 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde.
What is the SMILES notation for 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde?
The canonical SMILES for 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde is O=CC1CCOc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde?
The InChIKey is DQRVBEXRTJYKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c12-6-7-3-4-15-10-2-1-8(11(13)14)5-9(7)10/h1-2,5-7H,3-4H2.
What are the key properties of 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde?
6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde has a molecular weight of 207.19 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3,4-dihydro-2H-chromene-4-carbaldehyde is sourced from PubChem (CID 59397335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).